About potassium dicyclohexylazanide
potassium dicyclohexylazanide (PubChem CID 12552073) has the molecular formula C12H22KN
and a molecular weight of 219.41 g/mol. Its IUPAC name is potassium dicyclohexylazanide.
Molecular Properties
| Compound Name | potassium dicyclohexylazanide |
| PubChem CID | 12552073 |
| Molecular Formula | C12H22KN |
| Molecular Weight | 219.41 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | potassium dicyclohexylazanide |
| SMILES | C1CCC([N-]C2CCCCC2)CC1.[K+] |
| InChI | InChI=1S/C12H22N.K/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-12H,1-10H2;/q-1;+1 |
| InChIKey | RUOKERZPIANWCP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium dicyclohexylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium dicyclohexylazanide?
The IUPAC name of potassium dicyclohexylazanide (CID 12552073) is potassium dicyclohexylazanide.
What is the SMILES notation for potassium dicyclohexylazanide?
The canonical SMILES for potassium dicyclohexylazanide is C1CCC([N-]C2CCCCC2)CC1.[K+].
What is the InChIKey of potassium dicyclohexylazanide?
The InChIKey is RUOKERZPIANWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N.K/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-12H,1-10H2;/q-1;+1.
What are the key properties of potassium dicyclohexylazanide?
potassium dicyclohexylazanide has a molecular weight of 219.41 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium dicyclohexylazanide is sourced from PubChem (CID 12552073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).