C20H28O3 — CID 11012549
(3S,4S,8Z,11S,16R)-16-hydroxy-4,8,15,15-tetramethyltricyclo[9.3.1.13,14]hexadeca-1(14),8-diene-2,6-dione (PubChem CID 11012549) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3S,4S,8Z,11S,16R)-16-hydroxy-4,8,15,15-tetramethyltricyclo[9.3.1.13,14]hexadeca-1(14),8-diene-2,6-dione.
| Compound Name | (3S,4S,8Z,11S,16R)-16-hydroxy-4,8,15,15-tetramethyltricyclo[9.3.1.13,14]hexadeca-1(14),8-diene-2,6-dione |
|---|---|
| PubChem CID | 11012549 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3S,4S,8Z,11S,16R)-16-hydroxy-4,8,15,15-tetramethyltricyclo[9.3.1.13,14]hexadeca-1(14),8-diene-2,6-dione |
| SMILES | C/C1=C/C[C@@H]2CCC3=C(C(=O)[C@@H]([C@@H](C)CC(=O)C1)[C@H]3O)C2(C)C |
| InChI | InChI=1S/C20H28O3/c1-11-5-6-13-7-8-15-17(20(13,3)4)19(23)16(18(15)22)12(2)10-14(21)9-11/h5,12-13,16,18,22H,6-10H2,1-4H3/b11-5-/t12-,13+,16-,18-/m0/s1 |
| InChIKey | AXOPQHQNFSMCKW-ZSEYTQBKSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|