C19H16N2O3 — CID 11012630
(3E)-5-(2,4-dimethylphenyl)-3-[(3-nitrophenyl)methylidene]-1H-pyrrol-2-one (PubChem CID 11012630) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (3E)-5-(2,4-dimethylphenyl)-3-[(3-nitrophenyl)methylidene]-1H-pyrrol-2-one.
| Compound Name | (3E)-5-(2,4-dimethylphenyl)-3-[(3-nitrophenyl)methylidene]-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 11012630 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3E)-5-(2,4-dimethylphenyl)-3-[(3-nitrophenyl)methylidene]-1H-pyrrol-2-one |
| SMILES | Cc1ccc(C2=C/C(=C\c3cccc([N+](=O)[O-])c3)C(=O)N2)c(C)c1 |
| InChI | InChI=1S/C19H16N2O3/c1-12-6-7-17(13(2)8-12)18-11-15(19(22)20-18)9-14-4-3-5-16(10-14)21(23)24/h3-11H,1-2H3,(H,20,22)/b15-9+ |
| InChIKey | PDVZSUKXBDGCOJ-OQLLNIDSSA-N |
| XLogP | 3.77 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|