C11H20F2N2O2 — CID 110128719
(3R,4S,5R)-3-(4,4-difluoropiperidin-1-yl)azepane-4,5-diol (PubChem CID 110128719) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is (3R,4S,5R)-3-(4,4-difluoropiperidin-1-yl)azepane-4,5-diol.
| Compound Name | (3R,4S,5R)-3-(4,4-difluoropiperidin-1-yl)azepane-4,5-diol |
|---|---|
| PubChem CID | 110128719 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (3R,4S,5R)-3-(4,4-difluoropiperidin-1-yl)azepane-4,5-diol |
| SMILES | O[C@@H]1[C@H](O)CCNC[C@H]1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H20F2N2O2/c12-11(13)2-5-15(6-3-11)8-7-14-4-1-9(16)10(8)17/h8-10,14,16-17H,1-7H2/t8-,9-,10+/m1/s1 |
| InChIKey | RSINSEDTVMICNV-BBBLOLIVSA-N |
| XLogP | -0.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |