C18H18N2O5 — CID 11013292
(4R)-N-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 11013292) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is (4R)-N-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-N-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11013292 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (4R)-N-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | COc1cc(C2=N[C@@H](C(=O)NO)CO2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O5/c1-23-16-9-13(18-19-14(11-25-18)17(21)20-22)7-8-15(16)24-10-12-5-3-2-4-6-12/h2-9,14,22H,10-11H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | ZAHYRFXIHDIKGK-CQSZACIVSA-N |
| XLogP | 1.92 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|