C26H35N3O2 — CID 110134480
N-[(5S,6S,8R,10S)-9,9-dimethyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-2-methylpropanamide (PubChem CID 110134480) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-9,9-dimethyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-2-methylpropanamide.
| Compound Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110134480 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(Cn5cccn5)cc4)OCCC31C2 |
| InChI | InChI=1S/C26H35N3O2/c1-17(2)23(30)28-24-25(3,4)20-14-21-22(31-13-10-26(21,24)15-20)19-8-6-18(7-9-19)16-29-12-5-11-27-29/h5-9,11-12,17,20-22,24H,10,13-16H2,1-4H3,(H,28,30)/t20-,21-,22-,24+,26?/m1/s1 |
| InChIKey | VOFBCYWYAFYPBG-JDTCUODQSA-N |
| XLogP | 4.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |