C18H31NO6Si — CID 11014510
tert-butyl (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1,10-dioxa-3-azaspiro[4.5]dec-7-ene-3-carboxylate (PubChem CID 11014510) has the molecular formula C18H31NO6Si and a molecular weight of 385.53 g/mol. Its IUPAC name is tert-butyl (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1,10-dioxa-3-azaspiro[4.5]dec-7-ene-3-carboxylate.
| Compound Name | tert-butyl (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1,10-dioxa-3-azaspiro[4.5]dec-7-ene-3-carboxylate |
|---|---|
| PubChem CID | 11014510 |
| Molecular Formula | C18H31NO6Si |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | tert-butyl (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1,10-dioxa-3-azaspiro[4.5]dec-7-ene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(OCC=C[C@@H]2O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H31NO6Si/c1-16(2,3)23-14(20)19-12-18(24-15(19)21)13(10-9-11-22-18)25-26(7,8)17(4,5)6/h9-10,13H,11-12H2,1-8H3/t13-,18-/m0/s1 |
| InChIKey | DNBOCIRWLPSQPF-UGSOOPFHSA-N |
| XLogP | 4.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|