C12H23NO4Si — CID 14774930
methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydrooxazine-2-carboxylate (PubChem CID 14774930) has the molecular formula C12H23NO4Si and a molecular weight of 273.41 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 14774930 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydrooxazine-2-carboxylate |
| SMILES | COC(=O)N1OCC=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23NO4Si/c1-12(2,3)18(5,6)17-10-8-7-9-16-13(10)11(14)15-4/h7-8,10H,9H2,1-6H3 |
| InChIKey | LCWWBRHVPWBILM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|