C26H35N5O2 — CID 110152347
1-[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-N-methyl-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 110152347) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-N-methyl-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-N-methyl-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110152347 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 1-[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-N-methyl-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1(c2ccccn2)CCCN(CC(=O)Nc2ccc(N3CCCCCC3)cc2)C1 |
| InChI | InChI=1S/C26H35N5O2/c1-27-25(33)26(23-9-4-5-15-28-23)14-8-16-30(20-26)19-24(32)29-21-10-12-22(13-11-21)31-17-6-2-3-7-18-31/h4-5,9-13,15H,2-3,6-8,14,16-20H2,1H3,(H,27,33)(H,29,32) |
| InChIKey | NBFQILPAFKZGBO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|