C23H29N5O2 — CID 124959329
(3S)-1-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 124959329) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (3S)-1-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 124959329 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (3S)-1-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | NC(=O)[C@@]1(c2ccccn2)CCCN(CC(=O)Nc2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C23H29N5O2/c24-22(30)23(20-6-1-2-12-25-20)11-5-13-27(17-23)16-21(29)26-18-7-9-19(10-8-18)28-14-3-4-15-28/h1-2,6-10,12H,3-5,11,13-17H2,(H2,24,30)(H,26,29)/t23-/m0/s1 |
| InChIKey | GMOKMYRENOWFED-QHCPKHFHSA-N |
| XLogP | 2.14 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|