C24H25N5O3 — CID 125026870
(3R)-1-[2-oxo-2-(4-pyridin-3-yloxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 125026870) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is (3R)-1-[2-oxo-2-(4-pyridin-3-yloxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-oxo-2-(4-pyridin-3-yloxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125026870 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (3R)-1-[2-oxo-2-(4-pyridin-3-yloxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(c2ccccn2)CCCN(CC(=O)Nc2ccc(Oc3cccnc3)cc2)C1 |
| InChI | InChI=1S/C24H25N5O3/c25-23(31)24(21-6-1-2-13-27-21)11-4-14-29(17-24)16-22(30)28-18-7-9-19(10-8-18)32-20-5-3-12-26-15-20/h1-3,5-10,12-13,15H,4,11,14,16-17H2,(H2,25,31)(H,28,30)/t24-/m1/s1 |
| InChIKey | ZWTUVVRDOZGKCF-XMMPIXPASA-N |
| XLogP | 2.73 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |