C25H26N4O3 — CID 129458524
(3R)-1-[2-oxo-2-(4-phenoxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 129458524) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is (3R)-1-[2-oxo-2-(4-phenoxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-oxo-2-(4-phenoxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129458524 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (3R)-1-[2-oxo-2-(4-phenoxyanilino)ethyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(c2ccccn2)CCCN(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H26N4O3/c26-24(31)25(22-9-4-5-15-27-22)14-6-16-29(18-25)17-23(30)28-19-10-12-21(13-11-19)32-20-7-2-1-3-8-20/h1-5,7-13,15H,6,14,16-18H2,(H2,26,31)(H,28,30)/t25-/m1/s1 |
| InChIKey | UFHDHMQUROSJRQ-RUZDIDTESA-N |
| XLogP | 3.33 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |