C20H19CrNO7 — CID 11015626
carbon monoxide;[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-pyrrolidin-1-ylpropylidene]chromium (PubChem CID 11015626) has the molecular formula C20H19CrNO7 and a molecular weight of 437.37 g/mol. Its IUPAC name is carbon monoxide;[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-pyrrolidin-1-ylpropylidene]chromium.
| Compound Name | carbon monoxide;[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-pyrrolidin-1-ylpropylidene]chromium |
|---|---|
| PubChem CID | 11015626 |
| Molecular Formula | C20H19CrNO7 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | carbon monoxide;[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-pyrrolidin-1-ylpropylidene]chromium |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]=C(CCC1COc2ccccc2O1)N1CCCC1 |
| InChI | InChI=1S/C15H19NO2.5CO.Cr/c1-2-8-15-14(7-1)17-12-13(18-15)6-5-11-16-9-3-4-10-16;5*1-2;/h1-2,7-8,13H,3-6,9-10,12H2;;;;;; |
| InChIKey | QAKVAWOCZVVRBP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 121.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|