C20H26N2O3 — CID 110156921
(2,3-dimethyl-1H-indol-5-yl)-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone (PubChem CID 110156921) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone |
|---|---|
| PubChem CID | 110156921 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone |
| SMILES | CO[C@H]1CCN(C(=O)c2ccc3[nH]c(C)c(C)c3c2)C[C@@]12CCCO2 |
| InChI | InChI=1S/C20H26N2O3/c1-13-14(2)21-17-6-5-15(11-16(13)17)19(23)22-9-7-18(24-3)20(12-22)8-4-10-25-20/h5-6,11,18,21H,4,7-10,12H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | YMZGNJYGSNZMMW-ICSRJNTNSA-N |
| XLogP | 3.19 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|