C20H28O7 — CID 110158143
(2S,3S,4R,5R,6S)-2-[[(2R,4R,4aR,7aR)-2-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 110158143) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-[[(2R,4R,4aR,7aR)-2-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-[[(2R,4R,4aR,7aR)-2-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 110158143 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-[[(2R,4R,4aR,7aR)-2-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@H](O[C@@H]2C[C@H](c3ccccc3)O[C@@H]3CCC[C@@H]23)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H28O7/c21-10-16-17(22)18(23)19(24)20(27-16)26-15-9-14(11-5-2-1-3-6-11)25-13-8-4-7-12(13)15/h1-3,5-6,12-24H,4,7-10H2/t12-,13-,14-,15-,16+,17+,18-,19+,20+/m1/s1 |
| InChIKey | HREUTUWILNMRSM-CFSOAWKOSA-N |
| XLogP | 0.50 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |