C25H30N4O3 — CID 110161737
2-[2-(3,5-dimethylphenoxy)ethylamino]-4-[3-(N-methylanilino)propyl]pyrimidine-5-carboxylic acid (PubChem CID 110161737) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethylamino]-4-[3-(N-methylanilino)propyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-(3,5-dimethylphenoxy)ethylamino]-4-[3-(N-methylanilino)propyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 110161737 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[2-(3,5-dimethylphenoxy)ethylamino]-4-[3-(N-methylanilino)propyl]pyrimidine-5-carboxylic acid |
| SMILES | Cc1cc(C)cc(OCCNc2ncc(C(=O)O)c(CCCN(C)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-18-14-19(2)16-21(15-18)32-13-11-26-25-27-17-22(24(30)31)23(28-25)10-7-12-29(3)20-8-5-4-6-9-20/h4-6,8-9,14-17H,7,10-13H2,1-3H3,(H,30,31)(H,26,27,28) |
| InChIKey | WJLZMRCLCCXFMO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|