C21H19F2N3O3 — CID 110165816
2-[2-(3-fluorophenoxy)ethylamino]-4-[2-(4-fluorophenyl)ethyl]pyrimidine-5-carboxylic acid (PubChem CID 110165816) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-[2-(3-fluorophenoxy)ethylamino]-4-[2-(4-fluorophenyl)ethyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-(3-fluorophenoxy)ethylamino]-4-[2-(4-fluorophenyl)ethyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 110165816 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[2-(3-fluorophenoxy)ethylamino]-4-[2-(4-fluorophenyl)ethyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCOc2cccc(F)c2)nc1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19F2N3O3/c22-15-7-4-14(5-8-15)6-9-19-18(20(27)28)13-25-21(26-19)24-10-11-29-17-3-1-2-16(23)12-17/h1-5,7-8,12-13H,6,9-11H2,(H,27,28)(H,24,25,26) |
| InChIKey | RSCWZXICOBYYHY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|