C21H19FO4 — CID 24784779
5-[2-[3-[2-(4-fluorophenyl)ethoxy]phenyl]ethyl]furan-2-carboxylic acid (PubChem CID 24784779) has the molecular formula C21H19FO4 and a molecular weight of 354.38 g/mol. Its IUPAC name is 5-[2-[3-[2-(4-fluorophenyl)ethoxy]phenyl]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-[3-[2-(4-fluorophenyl)ethoxy]phenyl]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 24784779 |
| Molecular Formula | C21H19FO4 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 5-[2-[3-[2-(4-fluorophenyl)ethoxy]phenyl]ethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCc2cccc(OCCc3ccc(F)cc3)c2)o1 |
| InChI | InChI=1S/C21H19FO4/c22-17-7-4-15(5-8-17)12-13-25-19-3-1-2-16(14-19)6-9-18-10-11-20(26-18)21(23)24/h1-5,7-8,10-11,14H,6,9,12-13H2,(H,23,24) |
| InChIKey | GCSJWQXDNCCLCW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |