C23H25FN8O4 — CID 110163639
N-[(1S,2S,3S)-3-(6-aminopurin-9-yl)-2-hydroxycyclohexyl]-3-[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 110163639) has the molecular formula C23H25FN8O4 and a molecular weight of 496.50 g/mol. Its IUPAC name is N-[(1S,2S,3S)-3-(6-aminopurin-9-yl)-2-hydroxycyclohexyl]-3-[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[(1S,2S,3S)-3-(6-aminopurin-9-yl)-2-hydroxycyclohexyl]-3-[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 110163639 |
| Molecular Formula | C23H25FN8O4 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[(1S,2S,3S)-3-(6-aminopurin-9-yl)-2-hydroxycyclohexyl]-3-[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCC[C@H](NC(=O)CCC2(c3ccc(F)cc3)NC(=O)NC2=O)[C@@H]1O |
| InChI | InChI=1S/C23H25FN8O4/c24-13-6-4-12(5-7-13)23(21(35)30-22(36)31-23)9-8-16(33)29-14-2-1-3-15(18(14)34)32-11-28-17-19(25)26-10-27-20(17)32/h4-7,10-11,14-15,18,34H,1-3,8-9H2,(H,29,33)(H2,25,26,27)(H2,30,31,35,36)/t14-,15-,18-,23?/m0/s1 |
| InChIKey | TXQVSZGUSOGAPQ-JYUSDSKYSA-N |
| XLogP | 0.63 |
| TPSA | 177.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|