C17H17ClN6O — CID 10360939
N-[(1R,2R)-2-(6-aminopurin-9-yl)cyclopentyl]-3-chlorobenzamide (PubChem CID 10360939) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is N-[(1R,2R)-2-(6-aminopurin-9-yl)cyclopentyl]-3-chlorobenzamide.
| Compound Name | N-[(1R,2R)-2-(6-aminopurin-9-yl)cyclopentyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 10360939 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[(1R,2R)-2-(6-aminopurin-9-yl)cyclopentyl]-3-chlorobenzamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1CCC[C@H]1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN6O/c18-11-4-1-3-10(7-11)17(25)23-12-5-2-6-13(12)24-9-22-14-15(19)20-8-21-16(14)24/h1,3-4,7-9,12-13H,2,5-6H2,(H,23,25)(H2,19,20,21)/t12-,13-/m1/s1 |
| InChIKey | IEFYLJBVHTZKEA-CHWSQXEVSA-N |
| XLogP | 2.59 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |