C28H29NO6 — CID 110166529
4-[5-[[(1S,10S,12R,16S)-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-trien-13-yl]methyl]furan-2-yl]-2-hydroxybenzoic acid (PubChem CID 110166529) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 4-[5-[[(1S,10S,12R,16S)-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-trien-13-yl]methyl]furan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[5-[[(1S,10S,12R,16S)-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-trien-13-yl]methyl]furan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 110166529 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-[5-[[(1S,10S,12R,16S)-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-trien-13-yl]methyl]furan-2-yl]-2-hydroxybenzoic acid |
| SMILES | CC1(C)Oc2ccccc2[C@H]2O[C@H]3CCN(Cc4ccc(-c5ccc(C(=O)O)c(O)c5)o4)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C28H29NO6/c1-28(2)20-14-21-25(34-26(20)19-5-3-4-6-24(19)35-28)11-12-29(21)15-17-8-10-23(33-17)16-7-9-18(27(31)32)22(30)13-16/h3-10,13,20-21,25-26,30H,11-12,14-15H2,1-2H3,(H,31,32)/t20-,21+,25-,26+/m0/s1 |
| InChIKey | ZVEHVHCWVQPPFV-LHYMKVENSA-N |
| XLogP | 5.24 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |