C29H30F3NO5 — CID 11016871
4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-1-[(4-fluorophenyl)methyl]piperidin-1-ium;2-hydroxy-2-oxoacetate (PubChem CID 11016871) has the molecular formula C29H30F3NO5 and a molecular weight of 529.56 g/mol. Its IUPAC name is 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-1-[(4-fluorophenyl)methyl]piperidin-1-ium;2-hydroxy-2-oxoacetate.
| Compound Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-1-[(4-fluorophenyl)methyl]piperidin-1-ium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 11016871 |
| Molecular Formula | C29H30F3NO5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-1-[(4-fluorophenyl)methyl]piperidin-1-ium;2-hydroxy-2-oxoacetate |
| SMILES | Fc1ccc(C[NH+]2CCC(CCOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C27H28F3NO.C2H2O4/c28-24-7-1-21(2-8-24)19-31-16-13-20(14-17-31)15-18-32-27(22-3-9-25(29)10-4-22)23-5-11-26(30)12-6-23;3-1(4)2(5)6/h1-12,20,27H,13-19H2;(H,3,4)(H,5,6) |
| InChIKey | MKWCGGDBGMBBOY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|