C21H21F2N3O5 — CID 110169190
1-[(2,6-difluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-6-methoxy-4-oxo-1,5-naphthyridine-3-carboxamide (PubChem CID 110169190) has the molecular formula C21H21F2N3O5 and a molecular weight of 433.41 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-6-methoxy-4-oxo-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-6-methoxy-4-oxo-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 110169190 |
| Molecular Formula | C21H21F2N3O5 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-6-methoxy-4-oxo-1,5-naphthyridine-3-carboxamide |
| SMILES | COc1ccc2c(n1)c(=O)c(C(=O)NCC(OC)OC)cn2Cc1c(F)cccc1F |
| InChI | InChI=1S/C21H21F2N3O5/c1-29-17-8-7-16-19(25-17)20(27)13(21(28)24-9-18(30-2)31-3)11-26(16)10-12-14(22)5-4-6-15(12)23/h4-8,11,18H,9-10H2,1-3H3,(H,24,28) |
| InChIKey | FZAZOJKUILLARK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|