C22H16Br2N4O8S — CID 110169587
3-[2-(2,6-dibromo-4-nitrophenoxy)ethoxy]-1-(4-methylphenyl)sulfonyl-5-nitroindazole (PubChem CID 110169587) has the molecular formula C22H16Br2N4O8S and a molecular weight of 656.26 g/mol. Its IUPAC name is 3-[2-(2,6-dibromo-4-nitrophenoxy)ethoxy]-1-(4-methylphenyl)sulfonyl-5-nitroindazole.
| Compound Name | 3-[2-(2,6-dibromo-4-nitrophenoxy)ethoxy]-1-(4-methylphenyl)sulfonyl-5-nitroindazole |
|---|---|
| PubChem CID | 110169587 |
| Molecular Formula | C22H16Br2N4O8S |
| Molecular Weight | 656.26 g/mol |
| Exact Mass | 653.91 |
| IUPAC Name | 3-[2-(2,6-dibromo-4-nitrophenoxy)ethoxy]-1-(4-methylphenyl)sulfonyl-5-nitroindazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nc(OCCOc3c(Br)cc([N+](=O)[O-])cc3Br)c3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C22H16Br2N4O8S/c1-13-2-5-16(6-3-13)37(33,34)26-20-7-4-14(27(29)30)10-17(20)22(25-26)36-9-8-35-21-18(23)11-15(28(31)32)12-19(21)24/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | MLAMGVWMPFHJDT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 156.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.26 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|