C21H18N4S — CID 110170166
N-cyclobutyl-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine (PubChem CID 110170166) has the molecular formula C21H18N4S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-cyclobutyl-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine.
| Compound Name | N-cyclobutyl-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 110170166 |
| Molecular Formula | C21H18N4S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-cyclobutyl-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine |
| SMILES | c1ccc(-c2ccc(-c3nnc(NC4CCC4)c4ccccc34)s2)nc1 |
| InChI | InChI=1S/C21H18N4S/c1-2-9-16-15(8-1)20(24-25-21(16)23-14-6-5-7-14)19-12-11-18(26-19)17-10-3-4-13-22-17/h1-4,8-14H,5-7H2,(H,23,25) |
| InChIKey | SYLMEJPLPMLJGP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |