C22H23ClN4S — CID 110172996
N-(3-methylbutyl)-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine;hydrochloride (PubChem CID 110172996) has the molecular formula C22H23ClN4S and a molecular weight of 410.97 g/mol. Its IUPAC name is N-(3-methylbutyl)-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine;hydrochloride.
| Compound Name | N-(3-methylbutyl)-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 110172996 |
| Molecular Formula | C22H23ClN4S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(3-methylbutyl)-4-(5-pyridin-2-ylthiophen-2-yl)phthalazin-1-amine;hydrochloride |
| SMILES | CC(C)CCNc1nnc(-c2ccc(-c3ccccn3)s2)c2ccccc12.Cl |
| InChI | InChI=1S/C22H22N4S.ClH/c1-15(2)12-14-24-22-17-8-4-3-7-16(17)21(25-26-22)20-11-10-19(27-20)18-9-5-6-13-23-18;/h3-11,13,15H,12,14H2,1-2H3,(H,24,26);1H |
| InChIKey | RZCJKNKAILMOQU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |