C19H32ClN3O4 — CID 110174817
ethyl 4-[3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propyl]piperazin-4-ium-1-carboxylate chloride (PubChem CID 110174817) has the molecular formula C19H32ClN3O4 and a molecular weight of 401.94 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propyl]piperazin-4-ium-1-carboxylate chloride.
| Compound Name | ethyl 4-[3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propyl]piperazin-4-ium-1-carboxylate chloride |
|---|---|
| PubChem CID | 110174817 |
| Molecular Formula | C19H32ClN3O4 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | ethyl 4-[3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propyl]piperazin-4-ium-1-carboxylate chloride |
| SMILES | CCOC(=O)N1CC[NH+](CCCN2C(=O)CC3(CCCCC3)C2=O)CC1.[Cl-] |
| InChI | InChI=1S/C19H31N3O4.ClH/c1-2-26-18(25)21-13-11-20(12-14-21)9-6-10-22-16(23)15-19(17(22)24)7-4-3-5-8-19;/h2-15H2,1H3;1H |
| InChIKey | OKSGRQNOVHIDHP-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|