C25H22Cl2O4 — CID 110175364
[4-[(4-acetyloxy-3-methylphenyl)-(3,4-dichlorophenyl)methyl]-2-methylphenyl] acetate (PubChem CID 110175364) has the molecular formula C25H22Cl2O4 and a molecular weight of 457.35 g/mol. Its IUPAC name is [4-[(4-acetyloxy-3-methylphenyl)-(3,4-dichlorophenyl)methyl]-2-methylphenyl] acetate.
| Compound Name | [4-[(4-acetyloxy-3-methylphenyl)-(3,4-dichlorophenyl)methyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 110175364 |
| Molecular Formula | C25H22Cl2O4 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [4-[(4-acetyloxy-3-methylphenyl)-(3,4-dichlorophenyl)methyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(c2ccc(OC(C)=O)c(C)c2)c2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C25H22Cl2O4/c1-14-11-18(6-9-23(14)30-16(3)28)25(20-5-8-21(26)22(27)13-20)19-7-10-24(15(2)12-19)31-17(4)29/h5-13,25H,1-4H3 |
| InChIKey | DAAAVMAHOQHIKJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|