C17H26ClNO3 — CID 110175936
cyclohexyl-[3-(2,5-dimethoxyphenyl)-3-oxopropyl]azanium chloride (PubChem CID 110175936) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is cyclohexyl-[3-(2,5-dimethoxyphenyl)-3-oxopropyl]azanium chloride.
| Compound Name | cyclohexyl-[3-(2,5-dimethoxyphenyl)-3-oxopropyl]azanium chloride |
|---|---|
| PubChem CID | 110175936 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | cyclohexyl-[3-(2,5-dimethoxyphenyl)-3-oxopropyl]azanium chloride |
| SMILES | COc1ccc(OC)c(C(=O)CC[NH2+]C2CCCCC2)c1.[Cl-] |
| InChI | InChI=1S/C17H25NO3.ClH/c1-20-14-8-9-17(21-2)15(12-14)16(19)10-11-18-13-6-4-3-5-7-13;/h8-9,12-13,18H,3-7,10-11H2,1-2H3;1H |
| InChIKey | OWMOIEPAUWPKBS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |