C16H31NS — CID 110177222
2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-diethylethanamine (PubChem CID 110177222) has the molecular formula C16H31NS and a molecular weight of 269.50 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-diethylethanamine.
| Compound Name | 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 110177222 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-diethylethanamine |
| SMILES | C=CC(C)(CCC=C(C)C)SCCN(CC)CC |
| InChI | InChI=1S/C16H31NS/c1-7-16(6,12-10-11-15(4)5)18-14-13-17(8-2)9-3/h7,11H,1,8-10,12-14H2,2-6H3 |
| InChIKey | LUOWIYWPKLQMBN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|