C14H29NS — CID 110180527
2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-dimethylethanamine (PubChem CID 110180527) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-dimethylethanamine.
| Compound Name | 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 110180527 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-dimethylethanamine |
| SMILES | CC(C)=CCCC(C)CCSCCN(C)C |
| InChI | InChI=1S/C14H29NS/c1-13(2)7-6-8-14(3)9-11-16-12-10-15(4)5/h7,14H,6,8-12H2,1-5H3 |
| InChIKey | XAWQYZAYOUHIFH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|