C16H33NS — CID 117060212
2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-diethylethanamine (PubChem CID 117060212) has the molecular formula C16H33NS and a molecular weight of 271.51 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-diethylethanamine.
| Compound Name | 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 117060212 |
| Molecular Formula | C16H33NS |
| Molecular Weight | 271.51 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enylsulfanyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C16H33NS/c1-6-17(7-2)12-14-18-13-11-16(5)10-8-9-15(3)4/h9,16H,6-8,10-14H2,1-5H3 |
| InChIKey | QLEXCBOEYHEBCN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|