C19H27ClN2O2 — CID 110179731
3-methyl-N-[3-(3-piperidin-1-ium-1-ylpropanoyl)phenyl]but-2-enamide chloride (PubChem CID 110179731) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 3-methyl-N-[3-(3-piperidin-1-ium-1-ylpropanoyl)phenyl]but-2-enamide chloride.
| Compound Name | 3-methyl-N-[3-(3-piperidin-1-ium-1-ylpropanoyl)phenyl]but-2-enamide chloride |
|---|---|
| PubChem CID | 110179731 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-methyl-N-[3-(3-piperidin-1-ium-1-ylpropanoyl)phenyl]but-2-enamide chloride |
| SMILES | CC(C)=CC(=O)Nc1cccc(C(=O)CC[NH+]2CCCCC2)c1.[Cl-] |
| InChI | InChI=1S/C19H26N2O2.ClH/c1-15(2)13-19(23)20-17-8-6-7-16(14-17)18(22)9-12-21-10-4-3-5-11-21;/h6-8,13-14H,3-5,9-12H2,1-2H3,(H,20,23);1H |
| InChIKey | LPBDOHZHFKYELA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|