C25H33ClN2O3 — CID 110180111
[1-(4-ethylphenyl)-1-hydroxypropan-2-yl]-[3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]azanium chloride (PubChem CID 110180111) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is [1-(4-ethylphenyl)-1-hydroxypropan-2-yl]-[3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]azanium chloride.
| Compound Name | [1-(4-ethylphenyl)-1-hydroxypropan-2-yl]-[3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]azanium chloride |
|---|---|
| PubChem CID | 110180111 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [1-(4-ethylphenyl)-1-hydroxypropan-2-yl]-[3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]azanium chloride |
| SMILES | CCc1ccc(C(O)C(C)[NH2+]CCC(=O)c2cccc(NC(=O)C=C(C)C)c2)cc1.[Cl-] |
| InChI | InChI=1S/C25H32N2O3.ClH/c1-5-19-9-11-20(12-10-19)25(30)18(4)26-14-13-23(28)21-7-6-8-22(16-21)27-24(29)15-17(2)3;/h6-12,15-16,18,25-26,30H,5,13-14H2,1-4H3,(H,27,29);1H |
| InChIKey | OARRIIDLYLRTJS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|