C19H22ClN3O2 — CID 110179787
[3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]-pyridin-3-ylazanium chloride (PubChem CID 110179787) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is [3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]-pyridin-3-ylazanium chloride.
| Compound Name | [3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]-pyridin-3-ylazanium chloride |
|---|---|
| PubChem CID | 110179787 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [3-[3-(3-methylbut-2-enoylamino)phenyl]-3-oxopropyl]-pyridin-3-ylazanium chloride |
| SMILES | CC(C)=CC(=O)Nc1cccc(C(=O)CC[NH2+]c2cccnc2)c1.[Cl-] |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-14(2)11-19(24)22-16-6-3-5-15(12-16)18(23)8-10-21-17-7-4-9-20-13-17;/h3-7,9,11-13,21H,8,10H2,1-2H3,(H,22,24);1H |
| InChIKey | ZJOLMPQLAXVFTI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|