C23H27ClN2O2S — CID 110180136
(E)-3-(4-methylphenyl)-N-[3-(3-thiomorpholin-4-ium-4-ylpropanoyl)phenyl]prop-2-enamide chloride (PubChem CID 110180136) has the molecular formula C23H27ClN2O2S and a molecular weight of 431.00 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-N-[3-(3-thiomorpholin-4-ium-4-ylpropanoyl)phenyl]prop-2-enamide chloride.
| Compound Name | (E)-3-(4-methylphenyl)-N-[3-(3-thiomorpholin-4-ium-4-ylpropanoyl)phenyl]prop-2-enamide chloride |
|---|---|
| PubChem CID | 110180136 |
| Molecular Formula | C23H27ClN2O2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (E)-3-(4-methylphenyl)-N-[3-(3-thiomorpholin-4-ium-4-ylpropanoyl)phenyl]prop-2-enamide chloride |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(C(=O)CC[NH+]3CCSCC3)c2)cc1.[Cl-] |
| InChI | InChI=1S/C23H26N2O2S.ClH/c1-18-5-7-19(8-6-18)9-10-23(27)24-21-4-2-3-20(17-21)22(26)11-12-25-13-15-28-16-14-25;/h2-10,17H,11-16H2,1H3,(H,24,27);1H/b10-9+; |
| InChIKey | WTINKOKNTIPSKI-RRABGKBLSA-N |
| XLogP | -0.14 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|