C20H29NO8 — CID 110183319
2-hydroxy-2-oxoacetate;(1-hydroxy-1-phenylpropan-2-yl)-(8-methoxy-3,8-dioxooctyl)azanium (PubChem CID 110183319) has the molecular formula C20H29NO8 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;(1-hydroxy-1-phenylpropan-2-yl)-(8-methoxy-3,8-dioxooctyl)azanium.
| Compound Name | 2-hydroxy-2-oxoacetate;(1-hydroxy-1-phenylpropan-2-yl)-(8-methoxy-3,8-dioxooctyl)azanium |
|---|---|
| PubChem CID | 110183319 |
| Molecular Formula | C20H29NO8 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;(1-hydroxy-1-phenylpropan-2-yl)-(8-methoxy-3,8-dioxooctyl)azanium |
| SMILES | COC(=O)CCCCC(=O)CC[NH2+]C(C)C(O)c1ccccc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C18H27NO4.C2H2O4/c1-14(18(22)15-8-4-3-5-9-15)19-13-12-16(20)10-6-7-11-17(21)23-2;3-1(4)2(5)6/h3-5,8-9,14,18-19,22H,6-7,10-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XLDDOIHDKLGXEH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|