C24H32ClFN4O3 — CID 110188812
3-[5-(ethoxycarbonylamino)-1-[(4-fluorophenyl)methyl]indazol-3-yl]oxypropyl-diethylazanium chloride (PubChem CID 110188812) has the molecular formula C24H32ClFN4O3 and a molecular weight of 479.00 g/mol. Its IUPAC name is 3-[5-(ethoxycarbonylamino)-1-[(4-fluorophenyl)methyl]indazol-3-yl]oxypropyl-diethylazanium chloride.
| Compound Name | 3-[5-(ethoxycarbonylamino)-1-[(4-fluorophenyl)methyl]indazol-3-yl]oxypropyl-diethylazanium chloride |
|---|---|
| PubChem CID | 110188812 |
| Molecular Formula | C24H32ClFN4O3 |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-[5-(ethoxycarbonylamino)-1-[(4-fluorophenyl)methyl]indazol-3-yl]oxypropyl-diethylazanium chloride |
| SMILES | CCOC(=O)Nc1ccc2c(c1)c(OCCC[NH+](CC)CC)nn2Cc1ccc(F)cc1.[Cl-] |
| InChI | InChI=1S/C24H31FN4O3.ClH/c1-4-28(5-2)14-7-15-32-23-21-16-20(26-24(30)31-6-3)12-13-22(21)29(27-23)17-18-8-10-19(25)11-9-18;/h8-13,16H,4-7,14-15,17H2,1-3H3,(H,26,30);1H |
| InChIKey | NNRSFRNYDZCDMG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|