C12H13ClN6O3 — CID 110191870
1-(2-chlorophenyl)-3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]urea (PubChem CID 110191870) has the molecular formula C12H13ClN6O3 and a molecular weight of 324.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]urea |
|---|---|
| PubChem CID | 110191870 |
| Molecular Formula | C12H13ClN6O3 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]urea |
| SMILES | COc1nc(NNC(=O)Nc2ccccc2Cl)nc(OC)n1 |
| InChI | InChI=1S/C12H13ClN6O3/c1-21-11-15-9(16-12(17-11)22-2)18-19-10(20)14-8-6-4-3-5-7(8)13/h3-6H,1-2H3,(H2,14,19,20)(H,15,16,17,18) |
| InChIKey | MZNMHFRSASGYGU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|