C10H12N6S8 — CID 110191950
2-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]tetrasulfanyl]-4,6-bis(methylsulfanyl)-1,3,5-triazine (PubChem CID 110191950) has the molecular formula C10H12N6S8 and a molecular weight of 472.78 g/mol. Its IUPAC name is 2-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]tetrasulfanyl]-4,6-bis(methylsulfanyl)-1,3,5-triazine.
| Compound Name | 2-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]tetrasulfanyl]-4,6-bis(methylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 110191950 |
| Molecular Formula | C10H12N6S8 |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 471.89 |
| IUPAC Name | 2-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]tetrasulfanyl]-4,6-bis(methylsulfanyl)-1,3,5-triazine |
| SMILES | CSc1nc(SC)nc(SSSSc2nc(SC)nc(SC)n2)n1 |
| InChI | InChI=1S/C10H12N6S8/c1-17-5-11-6(18-2)14-9(13-5)21-23-24-22-10-15-7(19-3)12-8(16-10)20-4/h1-4H3 |
| InChIKey | LNKAKXBARPDIIO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|