C9H17NOS — CID 110192132
1-(2,2-diethyl-1,3-thiazolidin-3-yl)ethanone (PubChem CID 110192132) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 1-(2,2-diethyl-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 1-(2,2-diethyl-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 110192132 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(2,2-diethyl-1,3-thiazolidin-3-yl)ethanone |
| SMILES | CCC1(CC)SCCN1C(C)=O |
| InChI | InChI=1S/C9H17NOS/c1-4-9(5-2)10(8(3)11)6-7-12-9/h4-7H2,1-3H3 |
| InChIKey | VRAKUDUFOSFHGR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |