C8H14OS2 — CID 14111946
1-(2-ethyl-1,3-dithiolan-2-yl)propan-2-one (PubChem CID 14111946) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-dithiolan-2-yl)propan-2-one.
| Compound Name | 1-(2-ethyl-1,3-dithiolan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 14111946 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-(2-ethyl-1,3-dithiolan-2-yl)propan-2-one |
| SMILES | CCC1(CC(C)=O)SCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-3-8(6-7(2)9)10-4-5-11-8/h3-6H2,1-2H3 |
| InChIKey | GBDCTGJPVWTEAQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |