C12H18O2S2 — CID 101380276
(2R,3S)-2-(2-oxopropyl)-6,10-dithiaspiro[4.5]decane-3-carbaldehyde (PubChem CID 101380276) has the molecular formula C12H18O2S2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2R,3S)-2-(2-oxopropyl)-6,10-dithiaspiro[4.5]decane-3-carbaldehyde.
| Compound Name | (2R,3S)-2-(2-oxopropyl)-6,10-dithiaspiro[4.5]decane-3-carbaldehyde |
|---|---|
| PubChem CID | 101380276 |
| Molecular Formula | C12H18O2S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (2R,3S)-2-(2-oxopropyl)-6,10-dithiaspiro[4.5]decane-3-carbaldehyde |
| SMILES | CC(=O)C[C@@H]1CC2(C[C@@H]1C=O)SCCCS2 |
| InChI | InChI=1S/C12H18O2S2/c1-9(14)5-10-6-12(7-11(10)8-13)15-3-2-4-16-12/h8,10-11H,2-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | HOIMKWCTGURHQW-GHMZBOCLSA-N |
| XLogP | 2.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|