2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid

C9H15NO2S2 — CID 21016321

IUPAC2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid
SMILESCN1CC2(CC1C(=O)O)SCCCS2
InChIInChI=1S/C9H15NO2S2/c1-10-6-9(5-7(10)8(11)12)13-3-2-4-14-9/h7H,2-6H2,1H3,(H,11,12)
InChIKeyNFICMIGIIQBHLN-UHFFFAOYSA-N
MW233.36 g/mol
LogP1.34
Rot. Bonds1

About 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid

2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid (PubChem CID 21016321) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid.

Molecular Properties

Compound Name2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid
PubChem CID21016321
Molecular FormulaC9H15NO2S2
Molecular Weight233.36 g/mol
Exact Mass233.05
IUPAC Name2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid
SMILESCN1CC2(CC1C(=O)O)SCCCS2
InChIInChI=1S/C9H15NO2S2/c1-10-6-9(5-7(10)8(11)12)13-3-2-4-14-9/h7H,2-6H2,1H3,(H,11,12)
InChIKeyNFICMIGIIQBHLN-UHFFFAOYSA-N
XLogP1.34
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.36
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid?
The IUPAC name of 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid (CID 21016321) is 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid.
What is the SMILES notation for 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid?
The canonical SMILES for 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid is CN1CC2(CC1C(=O)O)SCCCS2.
What is the InChIKey of 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid?
The InChIKey is NFICMIGIIQBHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S2/c1-10-6-9(5-7(10)8(11)12)13-3-2-4-14-9/h7H,2-6H2,1H3,(H,11,12).
What are the key properties of 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid?
2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid has a molecular weight of 233.36 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid is sourced from PubChem (CID 21016321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).