About (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid
(6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid (PubChem CID 90262412) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid.
Analyze (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid?
The IUPAC name of (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid (CID 90262412) is (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid.
What is the SMILES notation for (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid?
The canonical SMILES for (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid is CN1CC2(C[C@H]1C(=O)O)CC2(C)C.
What is the InChIKey of (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid?
The InChIKey is JIXWJNNDFBFYKI-BYDSUWOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-9(2)5-10(9)4-7(8(12)13)11(3)6-10/h7H,4-6H2,1-3H3,(H,12,13)/t7-,10?/m0/s1.
What are the key properties of (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid?
(6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid has a molecular weight of 183.25 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,2,5-trimethyl-5-azaspiro[2.4]heptane-6-carboxylic acid is sourced from PubChem (CID 90262412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).