C7H12O3S2-2 — CID 45094886
1-[(2S)-2-ethyl-1,1-dioxido-1,3-dithiolan-2-yl]ethanone (PubChem CID 45094886) has the molecular formula C7H12O3S2-2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(2S)-2-ethyl-1,1-dioxido-1,3-dithiolan-2-yl]ethanone.
| Compound Name | 1-[(2S)-2-ethyl-1,1-dioxido-1,3-dithiolan-2-yl]ethanone |
|---|---|
| PubChem CID | 45094886 |
| Molecular Formula | C7H12O3S2-2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 1-[(2S)-2-ethyl-1,1-dioxido-1,3-dithiolan-2-yl]ethanone |
| SMILES | CC[C@]1(C(C)=O)SCCS1([O-])[O-] |
| InChI | InChI=1S/C7H14O3S2/c1-3-7(6(2)8)11-4-5-12(7,9)10/h9-10H,3-5H2,1-2H3/p-2/t7-/m0/s1 |
| InChIKey | IXRLNDNQBBEBBJ-ZETCQYMHSA-L |
| XLogP | 1.49 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |