C23H20FN5 — CID 110194457
6-(4-fluorophenyl)-2-[3-(6-methyl-1H-benzimidazol-2-yl)propylamino]pyridine-3-carbonitrile (PubChem CID 110194457) has the molecular formula C23H20FN5 and a molecular weight of 385.45 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[3-(6-methyl-1H-benzimidazol-2-yl)propylamino]pyridine-3-carbonitrile.
| Compound Name | 6-(4-fluorophenyl)-2-[3-(6-methyl-1H-benzimidazol-2-yl)propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 110194457 |
| Molecular Formula | C23H20FN5 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[3-(6-methyl-1H-benzimidazol-2-yl)propylamino]pyridine-3-carbonitrile |
| SMILES | Cc1ccc2nc(CCCNc3nc(-c4ccc(F)cc4)ccc3C#N)[nH]c2c1 |
| InChI | InChI=1S/C23H20FN5/c1-15-4-10-20-21(13-15)28-22(27-20)3-2-12-26-23-17(14-25)7-11-19(29-23)16-5-8-18(24)9-6-16/h4-11,13H,2-3,12H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | IIBLRLXBZQFHCH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|