C21H17FN6 — CID 110194467
6-(4-fluorophenyl)-2-[3-(3H-imidazo[4,5-c]pyridin-2-yl)propylamino]pyridine-3-carbonitrile (PubChem CID 110194467) has the molecular formula C21H17FN6 and a molecular weight of 372.41 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[3-(3H-imidazo[4,5-c]pyridin-2-yl)propylamino]pyridine-3-carbonitrile.
| Compound Name | 6-(4-fluorophenyl)-2-[3-(3H-imidazo[4,5-c]pyridin-2-yl)propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 110194467 |
| Molecular Formula | C21H17FN6 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[3-(3H-imidazo[4,5-c]pyridin-2-yl)propylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(F)cc2)nc1NCCCc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C21H17FN6/c22-16-6-3-14(4-7-16)17-8-5-15(12-23)21(28-17)25-10-1-2-20-26-18-9-11-24-13-19(18)27-20/h3-9,11,13H,1-2,10H2,(H,25,28)(H,26,27) |
| InChIKey | SPIYJAQFSYSXSZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|