C16H12ClFN4 — CID 133378485
4-chloro-2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]benzonitrile (PubChem CID 133378485) has the molecular formula C16H12ClFN4 and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-chloro-2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]benzonitrile.
| Compound Name | 4-chloro-2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133378485 |
| Molecular Formula | C16H12ClFN4 |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-chloro-2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NCCc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H12ClFN4/c17-11-2-1-10(9-19)14(7-11)20-6-5-16-21-13-4-3-12(18)8-15(13)22-16/h1-4,7-8,20H,5-6H2,(H,21,22) |
| InChIKey | ZYNZVPYFPZDZEC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |