C19H29NO3 — CID 110209471
3-(1-adamantyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]but-2-enamide (PubChem CID 110209471) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]but-2-enamide.
| Compound Name | 3-(1-adamantyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 110209471 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-(1-adamantyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]but-2-enamide |
| SMILES | CC(=CC(=O)NCC1(CO)COC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H29NO3/c1-13(2-17(22)20-9-18(10-21)11-23-12-18)19-6-14-3-15(7-19)5-16(4-14)8-19/h2,14-16,21H,3-12H2,1H3,(H,20,22) |
| InChIKey | JRGURHKZESOWOG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|